C27H39N3O6 — CID 70093559
5-(3,4-dimethoxyphenyl)-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pentanoic acid (PubChem CID 70093559) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70093559 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pentanoic acid |
| SMILES | COc1ccc(CCC(CC(=O)O)NC(=O)[C@@H]2CCCN(C(=O)/C=C/C3CCNCC3)C2)cc1OC |
| InChI | InChI=1S/C27H39N3O6/c1-35-23-9-6-20(16-24(23)36-2)5-8-22(17-26(32)33)29-27(34)21-4-3-15-30(18-21)25(31)10-7-19-11-13-28-14-12-19/h6-7,9-10,16,19,21-22,28H,3-5,8,11-15,17-18H2,1-2H3,(H,29,34)(H,32,33)/b10-7+/t21-,22?/m1/s1 |
| InChIKey | PXXZNIACJAGEHE-DKLVNJGQSA-N |
| XLogP | 2.39 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|