C20H31N3O4 — CID 70090813
3-cyclopropyl-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 70090813) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-cyclopropyl-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70090813 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 3-cyclopropyl-3-[[(3R)-1-[(E)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)[C@@H]1CCCN(C(=O)/C=C/C2CCNCC2)C1)C1CC1 |
| InChI | InChI=1S/C20H31N3O4/c24-18(6-3-14-7-9-21-10-8-14)23-11-1-2-16(13-23)20(27)22-17(12-19(25)26)15-4-5-15/h3,6,14-17,21H,1-2,4-5,7-13H2,(H,22,27)(H,25,26)/b6-3+/t16-,17?/m1/s1 |
| InChIKey | RYDUQVDUANWHES-JDYBYAJRSA-N |
| XLogP | 1.15 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|