C19H24F3N3O6 — CID 18738212
(2S)-2-[[[(3R)-1-[(E)-3-(azetidin-3-yl)prop-2-enoyl]piperidine-3-carbonyl]amino]methyl]but-3-ynoic acid;2,2,2-trifluoroacetic acid (PubChem CID 18738212) has the molecular formula C19H24F3N3O6 and a molecular weight of 447.41 g/mol. Its IUPAC name is (2S)-2-[[[(3R)-1-[(E)-3-(azetidin-3-yl)prop-2-enoyl]piperidine-3-carbonyl]amino]methyl]but-3-ynoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[[(3R)-1-[(E)-3-(azetidin-3-yl)prop-2-enoyl]piperidine-3-carbonyl]amino]methyl]but-3-ynoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18738212 |
| Molecular Formula | C19H24F3N3O6 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2S)-2-[[[(3R)-1-[(E)-3-(azetidin-3-yl)prop-2-enoyl]piperidine-3-carbonyl]amino]methyl]but-3-ynoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C#C[C@@H](CNC(=O)[C@@H]1CCCN(C(=O)/C=C/C2CNC2)C1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N3O4.C2HF3O2/c1-2-13(17(23)24)10-19-16(22)14-4-3-7-20(11-14)15(21)6-5-12-8-18-9-12;3-2(4,5)1(6)7/h1,5-6,12-14,18H,3-4,7-11H2,(H,19,22)(H,23,24);(H,6,7)/b6-5+;/t13-,14+;/m0./s1 |
| InChIKey | IXFUMXIWPPTQSI-QETWXVPPSA-N |
| XLogP | 0.08 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|