C29H45N3O6 — CID 18738194
tert-butyl 4-[(E)-3-oxo-3-[(3R)-3-[[(2S)-2-pentoxycarbonylbut-3-ynyl]carbamoyl]piperidin-1-yl]prop-1-enyl]piperidine-1-carboxylate (PubChem CID 18738194) has the molecular formula C29H45N3O6 and a molecular weight of 531.69 g/mol. Its IUPAC name is tert-butyl 4-[(E)-3-oxo-3-[(3R)-3-[[(2S)-2-pentoxycarbonylbut-3-ynyl]carbamoyl]piperidin-1-yl]prop-1-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-3-oxo-3-[(3R)-3-[[(2S)-2-pentoxycarbonylbut-3-ynyl]carbamoyl]piperidin-1-yl]prop-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18738194 |
| Molecular Formula | C29H45N3O6 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | tert-butyl 4-[(E)-3-oxo-3-[(3R)-3-[[(2S)-2-pentoxycarbonylbut-3-ynyl]carbamoyl]piperidin-1-yl]prop-1-enyl]piperidine-1-carboxylate |
| SMILES | C#C[C@@H](CNC(=O)[C@@H]1CCCN(C(=O)/C=C/C2CCN(C(=O)OC(C)(C)C)CC2)C1)C(=O)OCCCCC |
| InChI | InChI=1S/C29H45N3O6/c1-6-8-9-19-37-27(35)23(7-2)20-30-26(34)24-11-10-16-32(21-24)25(33)13-12-22-14-17-31(18-15-22)28(36)38-29(3,4)5/h2,12-13,22-24H,6,8-11,14-21H2,1,3-5H3,(H,30,34)/b13-12+/t23-,24+/m0/s1 |
| InChIKey | ULEGCUWKHGEKCH-QKAOGNPNSA-N |
| XLogP | 3.53 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|