C28H39N3O6 — CID 70094699
tert-butyl 4-[3-[3-[(4-ethoxycarbonylphenyl)carbamoyl]piperidin-1-yl]-3-oxoprop-1-enyl]piperidine-1-carboxylate (PubChem CID 70094699) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-[(4-ethoxycarbonylphenyl)carbamoyl]piperidin-1-yl]-3-oxoprop-1-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-[(4-ethoxycarbonylphenyl)carbamoyl]piperidin-1-yl]-3-oxoprop-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70094699 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | tert-butyl 4-[3-[3-[(4-ethoxycarbonylphenyl)carbamoyl]piperidin-1-yl]-3-oxoprop-1-enyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCCN(C(=O)C=CC3CCN(C(=O)OC(C)(C)C)CC3)C2)cc1 |
| InChI | InChI=1S/C28H39N3O6/c1-5-36-26(34)21-9-11-23(12-10-21)29-25(33)22-7-6-16-31(19-22)24(32)13-8-20-14-17-30(18-15-20)27(35)37-28(2,3)4/h8-13,20,22H,5-7,14-19H2,1-4H3,(H,29,33) |
| InChIKey | VUKCGZZABKJFTJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|