C20H28F3N3O7 — CID 158623549
(3R)-3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]pent-4-ynoic acid;2,2,2-trifluoroacetic acid (PubChem CID 158623549) has the molecular formula C20H28F3N3O7 and a molecular weight of 479.45 g/mol. Its IUPAC name is (3R)-3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]pent-4-ynoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3R)-3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]pent-4-ynoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158623549 |
| Molecular Formula | C20H28F3N3O7 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (3R)-3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]pent-4-ynoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C#C[C@@H](CC(=O)O)NC(=O)[C@@H]1CCCN(C(=O)COC2CCNCC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O5.C2HF3O2/c1-2-14(10-17(23)24)20-18(25)13-4-3-9-21(11-13)16(22)12-26-15-5-7-19-8-6-15;3-2(4,5)1(6)7/h1,13-15,19H,3-12H2,(H,20,25)(H,23,24);(H,6,7)/t13-,14+;/m1./s1 |
| InChIKey | HYHLAUSVAPHCPL-DFQHDRSWSA-N |
| XLogP | 0.22 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|