C24H39N3O4 — CID 139679440
pentyl (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-ynoate (PubChem CID 139679440) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is pentyl (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-ynoate.
| Compound Name | pentyl (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 139679440 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | pentyl (3S)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-ynoate |
| SMILES | C#C[C@H](CC(=O)OCCCCC)NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1 |
| InChI | InChI=1S/C24H39N3O4/c1-3-5-6-16-31-23(29)17-21(4-2)26-24(30)20-8-7-15-27(18-20)22(28)10-9-19-11-13-25-14-12-19/h2,19-21,25H,3,5-18H2,1H3,(H,26,30)/t20-,21-/m1/s1 |
| InChIKey | FJUGLSFSYOSGLX-NHCUHLMSSA-N |
| XLogP | 2.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|