C19H31N3O4 — CID 70111505
(2S)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-enoic acid (PubChem CID 70111505) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is (2S)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-enoic acid.
| Compound Name | (2S)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 70111505 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | (2S)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]pent-4-enoic acid |
| SMILES | C=CC[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)C(=O)O |
| InChI | InChI=1S/C19H31N3O4/c1-2-4-16(19(25)26)21-18(24)15-5-3-12-22(13-15)17(23)7-6-14-8-10-20-11-9-14/h2,14-16,20H,1,3-13H2,(H,21,24)(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | VGMVJQOYYFAXFW-CVEARBPZSA-N |
| XLogP | 1.15 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|