C21H29N3O4 — CID 22466251
2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]benzoic acid (PubChem CID 22466251) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22466251 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)C1CCCN(C(=O)CCC2CCNCC2)C1 |
| InChI | InChI=1S/C21H29N3O4/c25-19(8-7-15-9-11-22-12-10-15)24-13-3-4-16(14-24)20(26)23-18-6-2-1-5-17(18)21(27)28/h1-2,5-6,15-16,22H,3-4,7-14H2,(H,23,26)(H,27,28) |
| InChIKey | PEIBPDBAGCEUKM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |