C23H33N3O4 — CID 70110829
2-phenyl-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 70110829) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-phenyl-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-phenyl-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70110829 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-phenyl-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C(CNC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H33N3O4/c27-21(9-8-17-10-12-24-13-11-17)26-14-4-7-19(16-26)22(28)25-15-20(23(29)30)18-5-2-1-3-6-18/h1-3,5-6,17,19-20,24H,4,7-16H2,(H,25,28)(H,29,30)/t19-,20?/m1/s1 |
| InChIKey | FTRSWHNGRLBZOJ-FIWHBWSRSA-N |
| XLogP | 1.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |