C24H40N4O5 — CID 23533823
(3S)-3-(cyclohexanecarbonylamino)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 23533823) has the molecular formula C24H40N4O5 and a molecular weight of 464.61 g/mol. Its IUPAC name is (3S)-3-(cyclohexanecarbonylamino)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(cyclohexanecarbonylamino)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23533823 |
| Molecular Formula | C24H40N4O5 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (3S)-3-(cyclohexanecarbonylamino)-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)C1CCCCC1)NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1 |
| InChI | InChI=1S/C24H40N4O5/c29-21(9-8-17-10-12-25-13-11-17)28-14-4-7-19(16-28)24(33)27-20(15-22(30)31)26-23(32)18-5-2-1-3-6-18/h17-20,25H,1-16H2,(H,26,32)(H,27,33)(H,30,31)/t19-,20+/m1/s1 |
| InChIKey | SFXBABCIHRJUMR-UXHICEINSA-N |
| XLogP | 1.62 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|