C25H36IN3O5 — CID 130369400
(3S)-3-[4-(2-iodoethoxy)phenyl]-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 130369400) has the molecular formula C25H36IN3O5 and a molecular weight of 585.48 g/mol. Its IUPAC name is (3S)-3-[4-(2-iodoethoxy)phenyl]-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-[4-(2-iodoethoxy)phenyl]-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 130369400 |
| Molecular Formula | C25H36IN3O5 |
| Molecular Weight | 585.48 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | (3S)-3-[4-(2-iodoethoxy)phenyl]-3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1ccc(OCCI)cc1 |
| InChI | InChI=1S/C25H36IN3O5/c26-11-15-34-21-6-4-19(5-7-21)22(16-24(31)32)28-25(33)20-2-1-14-29(17-20)23(30)8-3-18-9-12-27-13-10-18/h4-7,18,20,22,27H,1-3,8-17H2,(H,28,33)(H,31,32)/t20-,22+/m1/s1 |
| InChIKey | AWYIAHYLJXSBHQ-IRLDBZIGSA-N |
| XLogP | 3.15 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|