C32H40N4O5 — CID 144529372
3-[5-[2-(3-ethoxyphenyl)ethynyl]-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 144529372) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is 3-[5-[2-(3-ethoxyphenyl)ethynyl]-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[5-[2-(3-ethoxyphenyl)ethynyl]-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 144529372 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 3-[5-[2-(3-ethoxyphenyl)ethynyl]-3-pyridinyl]-3-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | CCOc1cccc(C#Cc2cncc(C(CC(=O)O)NC(=O)C3CCCN(C(=O)CCC4CCNCC4)C3)c2)c1 |
| InChI | InChI=1S/C32H40N4O5/c1-2-41-28-7-3-5-24(18-28)8-9-25-17-27(21-34-20-25)29(19-31(38)39)35-32(40)26-6-4-16-36(22-26)30(37)11-10-23-12-14-33-15-13-23/h3,5,7,17-18,20-21,23,26,29,33H,2,4,6,10-16,19,22H2,1H3,(H,35,40)(H,38,39) |
| InChIKey | NPEZRIKFTPZMNC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|