C29H44N4O6 — CID 91206384
(2R)-2-[[4-(3-methylbutoxy)benzoyl]amino]-2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 91206384) has the molecular formula C29H44N4O6 and a molecular weight of 544.69 g/mol. Its IUPAC name is (2R)-2-[[4-(3-methylbutoxy)benzoyl]amino]-2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[4-(3-methylbutoxy)benzoyl]amino]-2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91206384 |
| Molecular Formula | C29H44N4O6 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | (2R)-2-[[4-(3-methylbutoxy)benzoyl]amino]-2-[[1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | CC(C)CCOc1ccc(C(=O)N[C@@](C)(NC(=O)C2CCCN(C(=O)CCC3CCNCC3)C2)C(=O)O)cc1 |
| InChI | InChI=1S/C29H44N4O6/c1-20(2)14-18-39-24-9-7-22(8-10-24)26(35)31-29(3,28(37)38)32-27(36)23-5-4-17-33(19-23)25(34)11-6-21-12-15-30-16-13-21/h7-10,20-21,23,30H,4-6,11-19H2,1-3H3,(H,31,35)(H,32,36)(H,37,38)/t23?,29-/m0/s1 |
| InChIKey | SNLZCBSGZXMRIE-IZCXSWDTSA-N |
| XLogP | 2.78 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|