C19H35N5O6S — CID 90987352
(2S)-2-(dimethylsulfamoylamino)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 90987352) has the molecular formula C19H35N5O6S and a molecular weight of 461.59 g/mol. Its IUPAC name is (2S)-2-(dimethylsulfamoylamino)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-(dimethylsulfamoylamino)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90987352 |
| Molecular Formula | C19H35N5O6S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-2-(dimethylsulfamoylamino)-2-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | CN(C)S(=O)(=O)N[C@](C)(NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)C(=O)O |
| InChI | InChI=1S/C19H35N5O6S/c1-19(18(27)28,22-31(29,30)23(2)3)21-17(26)15-5-4-12-24(13-15)16(25)7-6-14-8-10-20-11-9-14/h14-15,20,22H,4-13H2,1-3H3,(H,21,26)(H,27,28)/t15-,19+/m1/s1 |
| InChIKey | XQSYUXVFBOZFKF-BEFAXECRSA-N |
| XLogP | -0.68 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|