C30H49N3O6 — CID 86758028
tert-butyl 4-[3-[(3R)-3-[[(3S)-5-(4-methylpentoxy)-5-oxopent-1-yn-3-yl]carbamoyl]piperidin-1-yl]-3-oxopropyl]piperidine-1-carboxylate (PubChem CID 86758028) has the molecular formula C30H49N3O6 and a molecular weight of 547.74 g/mol. Its IUPAC name is tert-butyl 4-[3-[(3R)-3-[[(3S)-5-(4-methylpentoxy)-5-oxopent-1-yn-3-yl]carbamoyl]piperidin-1-yl]-3-oxopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(3R)-3-[[(3S)-5-(4-methylpentoxy)-5-oxopent-1-yn-3-yl]carbamoyl]piperidin-1-yl]-3-oxopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86758028 |
| Molecular Formula | C30H49N3O6 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.36 |
| IUPAC Name | tert-butyl 4-[3-[(3R)-3-[[(3S)-5-(4-methylpentoxy)-5-oxopent-1-yn-3-yl]carbamoyl]piperidin-1-yl]-3-oxopropyl]piperidine-1-carboxylate |
| SMILES | C#C[C@H](CC(=O)OCCCC(C)C)NC(=O)[C@@H]1CCCN(C(=O)CCC2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C30H49N3O6/c1-7-25(20-27(35)38-19-9-10-22(2)3)31-28(36)24-11-8-16-33(21-24)26(34)13-12-23-14-17-32(18-15-23)29(37)39-30(4,5)6/h1,22-25H,8-21H2,2-6H3,(H,31,36)/t24-,25-/m1/s1 |
| InChIKey | HKFGMRYXJFDFTR-JWQCQUIFSA-N |
| XLogP | 4.14 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|