C19H27N3O4 — CID 86758041
(3S)-3-[[(3R)-1-[(Z)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pent-4-ynoic acid (PubChem CID 86758041) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (3S)-3-[[(3R)-1-[(Z)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pent-4-ynoic acid.
| Compound Name | (3S)-3-[[(3R)-1-[(Z)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 86758041 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3S)-3-[[(3R)-1-[(Z)-3-piperidin-4-ylprop-2-enoyl]piperidine-3-carbonyl]amino]pent-4-ynoic acid |
| SMILES | C#C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN(C(=O)/C=C\C2CCNCC2)C1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-16(12-18(24)25)21-19(26)15-4-3-11-22(13-15)17(23)6-5-14-7-9-20-10-8-14/h1,5-6,14-16,20H,3-4,7-13H2,(H,21,26)(H,24,25)/b6-5-/t15-,16-/m1/s1 |
| InChIKey | OGIBDOIXGXPEEO-ILNYKDOHSA-N |
| XLogP | 0.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|