C18H31N3O5 — CID 70180329
ethyl 3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]propanoate (PubChem CID 70180329) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl 3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70180329 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | ethyl 3-[[(3R)-1-(2-piperidin-4-yloxyacetyl)piperidine-3-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)[C@@H]1CCCN(C(=O)COC2CCNCC2)C1 |
| InChI | InChI=1S/C18H31N3O5/c1-2-25-17(23)7-10-20-18(24)14-4-3-11-21(12-14)16(22)13-26-15-5-8-19-9-6-15/h14-15,19H,2-13H2,1H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | QGAZFXGKRVKKMQ-CQSZACIVSA-N |
| XLogP | 0.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |