C16H29N3O5 — CID 138044979
ethyl 2-[2-[[3-(propylcarbamoyl)piperidine-1-carbonyl]amino]ethoxy]acetate (PubChem CID 138044979) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl 2-[2-[[3-(propylcarbamoyl)piperidine-1-carbonyl]amino]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[[3-(propylcarbamoyl)piperidine-1-carbonyl]amino]ethoxy]acetate |
|---|---|
| PubChem CID | 138044979 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | ethyl 2-[2-[[3-(propylcarbamoyl)piperidine-1-carbonyl]amino]ethoxy]acetate |
| SMILES | CCCNC(=O)C1CCCN(C(=O)NCCOCC(=O)OCC)C1 |
| InChI | InChI=1S/C16H29N3O5/c1-3-7-17-15(21)13-6-5-9-19(11-13)16(22)18-8-10-23-12-14(20)24-4-2/h13H,3-12H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | BYTZUNCMPXNAIX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|