C9H19N3O — CID 61295715
3-amino-N-propylpiperidine-1-carboxamide (PubChem CID 61295715) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-amino-N-propylpiperidine-1-carboxamide.
| Compound Name | 3-amino-N-propylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 61295715 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 3-amino-N-propylpiperidine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C9H19N3O/c1-2-5-11-9(13)12-6-3-4-8(10)7-12/h8H,2-7,10H2,1H3,(H,11,13) |
| InChIKey | KUKIHEFVHBNRLV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |