C12H22N2O3 — CID 95270427
(3R)-3-(1,3-dioxolan-2-yl)-N-propylpiperidine-1-carboxamide (PubChem CID 95270427) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3R)-3-(1,3-dioxolan-2-yl)-N-propylpiperidine-1-carboxamide.
| Compound Name | (3R)-3-(1,3-dioxolan-2-yl)-N-propylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95270427 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (3R)-3-(1,3-dioxolan-2-yl)-N-propylpiperidine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCC[C@@H](C2OCCO2)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-2-5-13-12(15)14-6-3-4-10(9-14)11-16-7-8-17-11/h10-11H,2-9H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | JUIGYGFILZZGNH-SNVBAGLBSA-N |
| XLogP | 1.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |