C26H43N3O7 — CID 70110253
1-cyclohexyloxycarbonyloxyethyl 3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoate (PubChem CID 70110253) has the molecular formula C26H43N3O7 and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70110253 |
| Molecular Formula | C26H43N3O7 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 3-[[(3R)-1-(3-piperidin-4-ylpropanoyl)piperidine-3-carbonyl]amino]propanoate |
| SMILES | CC(OC(=O)CCNC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C26H43N3O7/c1-19(35-26(33)36-22-7-3-2-4-8-22)34-24(31)13-16-28-25(32)21-6-5-17-29(18-21)23(30)10-9-20-11-14-27-15-12-20/h19-22,27H,2-18H2,1H3,(H,28,32)/t19?,21-/m1/s1 |
| InChIKey | MAVIKPBMPXBBJO-VGAJERRHSA-N |
| XLogP | 2.89 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|