C13H17F3N2O4 — CID 146099473
methyl (E)-4-oxo-4-[3-(2,2,2-trifluoroethylcarbamoyl)piperidin-1-yl]but-2-enoate (PubChem CID 146099473) has the molecular formula C13H17F3N2O4 and a molecular weight of 322.28 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-[3-(2,2,2-trifluoroethylcarbamoyl)piperidin-1-yl]but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-[3-(2,2,2-trifluoroethylcarbamoyl)piperidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 146099473 |
| Molecular Formula | C13H17F3N2O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | methyl (E)-4-oxo-4-[3-(2,2,2-trifluoroethylcarbamoyl)piperidin-1-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)N1CCCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H17F3N2O4/c1-22-11(20)5-4-10(19)18-6-2-3-9(7-18)12(21)17-8-13(14,15)16/h4-5,9H,2-3,6-8H2,1H3,(H,17,21)/b5-4+ |
| InChIKey | SGADFQUMCGFUTN-SNAWJCMRSA-N |
| XLogP | 0.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|