C20H27N3O2 — CID 75417785
N-cyclohexyl-1-[(E)-3-pyridin-3-ylprop-2-enoyl]piperidine-3-carboxamide (PubChem CID 75417785) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-cyclohexyl-1-[(E)-3-pyridin-3-ylprop-2-enoyl]piperidine-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[(E)-3-pyridin-3-ylprop-2-enoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 75417785 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-cyclohexyl-1-[(E)-3-pyridin-3-ylprop-2-enoyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCCN(C(=O)/C=C/c2cccnc2)C1 |
| InChI | InChI=1S/C20H27N3O2/c24-19(11-10-16-6-4-12-21-14-16)23-13-5-7-17(15-23)20(25)22-18-8-2-1-3-9-18/h4,6,10-12,14,17-18H,1-3,5,7-9,13,15H2,(H,22,25)/b11-10+ |
| InChIKey | HOVIDYMMTFLNTD-ZHACJKMWSA-N |
| XLogP | 2.78 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|