C19H20N2O — CID 75407724
(E)-1-(3-benzylpyrrolidin-1-yl)-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 75407724) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (E)-1-(3-benzylpyrrolidin-1-yl)-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-(3-benzylpyrrolidin-1-yl)-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 75407724 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (E)-1-(3-benzylpyrrolidin-1-yl)-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccnc1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H20N2O/c22-19(9-8-17-7-4-11-20-14-17)21-12-10-18(15-21)13-16-5-2-1-3-6-16/h1-9,11,14,18H,10,12-13,15H2/b9-8+ |
| InChIKey | AXXYDVNYWZKWPX-CMDGGOBGSA-N |
| XLogP | 3.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|