C23H24N6O — CID 171147541
3-pyridin-3-yl-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 171147541) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 3-pyridin-3-yl-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-pyridin-3-yl-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171147541 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 3-pyridin-3-yl-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccnc1)N1CCCC(Cc2cnc(Nc3ccccn3)cn2)C1 |
| InChI | InChI=1S/C23H24N6O/c30-23(9-8-18-5-3-10-24-14-18)29-12-4-6-19(17-29)13-20-15-27-22(16-26-20)28-21-7-1-2-11-25-21/h1-3,5,7-11,14-16,19H,4,6,12-13,17H2,(H,25,27,28) |
| InChIKey | IPPQEKMDLDMDDX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|