C21H28N6O — CID 132777960
(E)-4-(dimethylamino)-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]but-2-en-1-one (PubChem CID 132777960) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 132777960 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[[5-(pyridin-2-ylamino)pyrazin-2-yl]methyl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCCC(Cc2cnc(Nc3ccccn3)cn2)C1 |
| InChI | InChI=1S/C21H28N6O/c1-26(2)11-6-9-21(28)27-12-5-7-17(16-27)13-18-14-24-20(15-23-18)25-19-8-3-4-10-22-19/h3-4,6,8-10,14-15,17H,5,7,11-13,16H2,1-2H3,(H,22,24,25)/b9-6+ |
| InChIKey | DVTLEFKMQAWGBE-RMKNXTFCSA-N |
| XLogP | 2.51 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|