C23H26N6O — CID 132778311
(E)-3-(2-methylpyrazol-3-yl)-1-[3-[[6-(pyridin-2-ylamino)-2-pyridinyl]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 132778311) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is (E)-3-(2-methylpyrazol-3-yl)-1-[3-[[6-(pyridin-2-ylamino)-2-pyridinyl]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-methylpyrazol-3-yl)-1-[3-[[6-(pyridin-2-ylamino)-2-pyridinyl]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 132778311 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (E)-3-(2-methylpyrazol-3-yl)-1-[3-[[6-(pyridin-2-ylamino)-2-pyridinyl]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cn1nccc1/C=C/C(=O)N1CCCC(Cc2cccc(Nc3ccccn3)n2)C1 |
| InChI | InChI=1S/C23H26N6O/c1-28-20(12-14-25-28)10-11-23(30)29-15-5-6-18(17-29)16-19-7-4-9-22(26-19)27-21-8-2-3-13-24-21/h2-4,7-14,18H,5-6,15-17H2,1H3,(H,24,26,27)/b11-10+ |
| InChIKey | DWACZDGKLFNZSX-ZHACJKMWSA-N |
| XLogP | 3.45 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|