C17H21N5O — CID 95822420
1-[(3R)-3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 95822420) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[(3R)-3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[(3R)-3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95822420 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-[(3R)-3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC[C@@H](c2cnc(Nc3ccccn3)cn2)C1 |
| InChI | InChI=1S/C17H21N5O/c1-2-17(23)22-9-5-6-13(12-22)14-10-20-16(11-19-14)21-15-7-3-4-8-18-15/h3-4,7-8,10-11,13H,2,5-6,9,12H2,1H3,(H,18,20,21)/t13-/m1/s1 |
| InChIKey | CVBZUICTNUMOKO-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |