C23H27N7O — CID 132766485
(E)-1-[3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 132766485) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is (E)-1-[3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 132766485 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (E)-1-[3-[5-(pyridin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)N1CCCC(c2cnc(Nc3ccccn3)cn2)C1 |
| InChI | InChI=1S/C23H27N7O/c1-16-19(17(2)29(3)28-16)9-10-23(31)30-12-6-7-18(15-30)20-13-26-22(14-25-20)27-21-8-4-5-11-24-21/h4-5,8-11,13-14,18H,6-7,12,15H2,1-3H3,(H,24,26,27)/b10-9+ |
| InChIKey | UQRYEYWCQZEIKS-MDZDMXLPSA-N |
| XLogP | 3.38 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|