C20H21N5OS2 — CID 171147302
3-(2-methyl-1,3-thiazol-4-yl)-1-[3-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 171147302) has the molecular formula C20H21N5OS2 and a molecular weight of 411.56 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-1-[3-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-1-[3-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171147302 |
| Molecular Formula | C20H21N5OS2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-1-[3-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc(C=CC(=O)N2CCCC(c3csc(Nc4ccccn4)n3)C2)cs1 |
| InChI | InChI=1S/C20H21N5OS2/c1-14-22-16(12-27-14)7-8-19(26)25-10-4-5-15(11-25)17-13-28-20(23-17)24-18-6-2-3-9-21-18/h2-3,6-9,12-13,15H,4-5,10-11H2,1H3,(H,21,23,24) |
| InChIKey | JTUNHGMQLYCXSP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|