C14H18N2O3S — CID 76954170
2-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-3-yl]acetic acid (PubChem CID 76954170) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 76954170 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-3-yl]acetic acid |
| SMILES | Cc1nc(C=CC(=O)N2CCCC(CC(=O)O)C2)cs1 |
| InChI | InChI=1S/C14H18N2O3S/c1-10-15-12(9-20-10)4-5-13(17)16-6-2-3-11(8-16)7-14(18)19/h4-5,9,11H,2-3,6-8H2,1H3,(H,18,19) |
| InChIKey | NLSQDAPDLLYUQR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|