C15H20N2O3S — CID 76937524
3-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-4-yl]propanoic acid (PubChem CID 76937524) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 76937524 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[1-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]piperidin-4-yl]propanoic acid |
| SMILES | Cc1nc(C=CC(=O)N2CCC(CCC(=O)O)CC2)cs1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-16-13(10-21-11)3-4-14(18)17-8-6-12(7-9-17)2-5-15(19)20/h3-4,10,12H,2,5-9H2,1H3,(H,19,20) |
| InChIKey | PRNVJOVEQZFRCW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|