C19H22N2O2S — CID 110887273
1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 110887273) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 110887273 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nc(C=CC(=O)N2CCC(C(O)c3ccccc3)CC2)cs1 |
| InChI | InChI=1S/C19H22N2O2S/c1-14-20-17(13-24-14)7-8-18(22)21-11-9-16(10-12-21)19(23)15-5-3-2-4-6-15/h2-8,13,16,19,23H,9-12H2,1H3 |
| InChIKey | SKEIJVLWFZHYLI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|