C13H19N3OS — CID 78835941
(E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 78835941) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78835941 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nc(/C=C/C(=O)N2CCCN(C)CC2)cs1 |
| InChI | InChI=1S/C13H19N3OS/c1-11-14-12(10-18-11)4-5-13(17)16-7-3-6-15(2)8-9-16/h4-5,10H,3,6-9H2,1-2H3/b5-4+ |
| InChIKey | PQSNUPGKCPHPBY-SNAWJCMRSA-N |
| XLogP | 1.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|