C19H18N4O2S — CID 132771012
(E)-3-(furan-2-yl)-1-[2-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 132771012) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-[2-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-[2-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 132771012 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-[2-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CCCC1c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C19H18N4O2S/c24-18(9-8-14-5-4-12-25-14)23-11-3-6-16(23)15-13-26-19(21-15)22-17-7-1-2-10-20-17/h1-2,4-5,7-10,12-13,16H,3,6,11H2,(H,20,21,22)/b9-8+ |
| InChIKey | CSGYUKCVBFRXOG-CMDGGOBGSA-N |
| XLogP | 4.25 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|