C16H20N6O2 — CID 110256403
2-methoxy-1-[3-[5-(pyrimidin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 110256403) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-methoxy-1-[3-[5-(pyrimidin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[3-[5-(pyrimidin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110256403 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-methoxy-1-[3-[5-(pyrimidin-2-ylamino)pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCCC(c2cnc(Nc3ncccn3)cn2)C1 |
| InChI | InChI=1S/C16H20N6O2/c1-24-11-15(23)22-7-2-4-12(10-22)13-8-20-14(9-19-13)21-16-17-5-3-6-18-16/h3,5-6,8-9,12H,2,4,7,10-11H2,1H3,(H,17,18,20,21) |
| InChIKey | JYXSQYAGQRVIJD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |