C16H22N6 — CID 110256171
5-(1-propan-2-ylpiperidin-3-yl)-N-pyrimidin-2-ylpyrazin-2-amine (PubChem CID 110256171) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-(1-propan-2-ylpiperidin-3-yl)-N-pyrimidin-2-ylpyrazin-2-amine.
| Compound Name | 5-(1-propan-2-ylpiperidin-3-yl)-N-pyrimidin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 110256171 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 5-(1-propan-2-ylpiperidin-3-yl)-N-pyrimidin-2-ylpyrazin-2-amine |
| SMILES | CC(C)N1CCCC(c2cnc(Nc3ncccn3)cn2)C1 |
| InChI | InChI=1S/C16H22N6/c1-12(2)22-8-3-5-13(11-22)14-9-20-15(10-19-14)21-16-17-6-4-7-18-16/h4,6-7,9-10,12-13H,3,5,8,11H2,1-2H3,(H,17,18,20,21) |
| InChIKey | JFDSTESDHLTCAZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |