C23H35FN6O6 — CID 126679453
benzyl N-[(2S)-1-[[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 126679453) has the molecular formula C23H35FN6O6 and a molecular weight of 510.57 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 126679453 |
| Molecular Formula | C23H35FN6O6 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C23H35FN6O6/c1-14(2)19(30-23(35)36-13-15-7-4-3-5-8-15)21(34)29-17(12-31)20(33)28-16(18(32)11-24)9-6-10-27-22(25)26/h3-5,7-8,14,16-17,19,31H,6,9-13H2,1-2H3,(H,28,33)(H,29,34)(H,30,35)(H4,25,26,27)/t16-,17-,19-/m0/s1 |
| InChIKey | OFDILNLXAMBGLU-LNLFQRSKSA-N |
| XLogP | -0.51 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|