C32H37N7O7 — CID 139661176
benzyl N-[2-[[2-[[(2S)-1-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenyl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 139661176) has the molecular formula C32H37N7O7 and a molecular weight of 631.69 g/mol. Its IUPAC name is benzyl N-[2-[[2-[[(2S)-1-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenyl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[2-[[(2S)-1-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenyl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 139661176 |
| Molecular Formula | C32H37N7O7 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | benzyl N-[2-[[2-[[(2S)-1-[2-(2-amino-1-hydroxy-2-oxo-1-phenylethyl)phenyl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | NC(=O)C(O)(c1ccccc1)c1ccccc1C(=O)[C@H](CCCN=C(N)N)NC(=O)CNC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H37N7O7/c33-29(43)32(45,22-12-5-2-6-13-22)24-15-8-7-14-23(24)28(42)25(16-9-17-36-30(34)35)39-27(41)19-37-26(40)18-38-31(44)46-20-21-10-3-1-4-11-21/h1-8,10-15,25,45H,9,16-20H2,(H2,33,43)(H,37,40)(H,38,44)(H,39,41)(H4,34,35,36)/t25-,32?/m0/s1 |
| InChIKey | PLADLFBCOOVOSQ-HKIGIVDHSA-N |
| XLogP | 0.17 |
| TPSA | 241.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|