C24H32ClNO5S — CID 67938057
2-[3-[2-[(4-chlorophenyl)sulfonyl-octylamino]ethyl]phenoxy]acetic acid (PubChem CID 67938057) has the molecular formula C24H32ClNO5S and a molecular weight of 482.04 g/mol. Its IUPAC name is 2-[3-[2-[(4-chlorophenyl)sulfonyl-octylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-[(4-chlorophenyl)sulfonyl-octylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67938057 |
| Molecular Formula | C24H32ClNO5S |
| Molecular Weight | 482.04 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[3-[2-[(4-chlorophenyl)sulfonyl-octylamino]ethyl]phenoxy]acetic acid |
| SMILES | CCCCCCCCN(CCc1cccc(OCC(=O)O)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClNO5S/c1-2-3-4-5-6-7-16-26(32(29,30)23-13-11-21(25)12-14-23)17-15-20-9-8-10-22(18-20)31-19-24(27)28/h8-14,18H,2-7,15-17,19H2,1H3,(H,27,28) |
| InChIKey | FOACBXLIKJXYEC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.04 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|