C15H17NO4S — CID 170421489
3-methyl-8-(2-methylpropanoylamino)naphthalene-1-sulfonic acid (PubChem CID 170421489) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-methyl-8-(2-methylpropanoylamino)naphthalene-1-sulfonic acid.
| Compound Name | 3-methyl-8-(2-methylpropanoylamino)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 170421489 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-methyl-8-(2-methylpropanoylamino)naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2c(NC(=O)C(C)C)cccc2c1 |
| InChI | InChI=1S/C15H17NO4S/c1-9(2)15(17)16-12-6-4-5-11-7-10(3)8-13(14(11)12)21(18,19)20/h4-9H,1-3H3,(H,16,17)(H,18,19,20) |
| InChIKey | NQOXUJJZEPEQHE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|