C17H24N6O8S2 — CID 58609465
2-ethenyl-5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 58609465) has the molecular formula C17H24N6O8S2 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-ethenyl-5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-ethenyl-5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 58609465 |
| Molecular Formula | C17H24N6O8S2 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 2-ethenyl-5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | C=Cc1ccc(Nc2nc(NCCOCCO)nc(NCCS(=O)(=O)O)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H24N6O8S2/c1-2-12-3-4-13(11-14(12)33(28,29)30)20-17-22-15(18-5-8-31-9-7-24)21-16(23-17)19-6-10-32(25,26)27/h2-4,11,24H,1,5-10H2,(H,25,26,27)(H,28,29,30)(H3,18,19,20,21,22,23) |
| InChIKey | RMAYCAPNTBXPOA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 212.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|