C18H24N6O8S2 — CID 72642425
5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[2-(trioxidanylsulfanyl)ethylideneamino]-1,3,5-triazin-2-yl]amino]-2-prop-1-enylbenzenesulfonic acid (PubChem CID 72642425) has the molecular formula C18H24N6O8S2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[2-(trioxidanylsulfanyl)ethylideneamino]-1,3,5-triazin-2-yl]amino]-2-prop-1-enylbenzenesulfonic acid.
| Compound Name | 5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[2-(trioxidanylsulfanyl)ethylideneamino]-1,3,5-triazin-2-yl]amino]-2-prop-1-enylbenzenesulfonic acid |
|---|---|
| PubChem CID | 72642425 |
| Molecular Formula | C18H24N6O8S2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 5-[[4-[2-(2-hydroxyethoxy)ethylamino]-6-[2-(trioxidanylsulfanyl)ethylideneamino]-1,3,5-triazin-2-yl]amino]-2-prop-1-enylbenzenesulfonic acid |
| SMILES | CC=Cc1ccc(Nc2nc(N=CCSOOO)nc(NCCOCCO)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C18H24N6O8S2/c1-2-3-13-4-5-14(12-15(13)34(27,28)29)21-18-23-16(19-6-9-30-10-8-25)22-17(24-18)20-7-11-33-32-31-26/h2-5,7,12,25-26H,6,8-11H2,1H3,(H,27,28,29)(H2,19,21,22,23,24) |
| InChIKey | KSHKIBLKUNIGCD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 197.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|