C22H27ClN2O3 — CID 92878144
2-[4-[[(2R)-2-(2-chlorophenyl)azepan-1-yl]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 92878144) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 2-[4-[[(2R)-2-(2-chlorophenyl)azepan-1-yl]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[[(2R)-2-(2-chlorophenyl)azepan-1-yl]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 92878144 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[4-[[(2R)-2-(2-chlorophenyl)azepan-1-yl]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CN2CCCCC[C@@H]2c2ccccc2Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H27ClN2O3/c1-27-21-13-16(10-11-20(21)28-15-22(24)26)14-25-12-6-2-3-9-19(25)17-7-4-5-8-18(17)23/h4-5,7-8,10-11,13,19H,2-3,6,9,12,14-15H2,1H3,(H2,24,26)/t19-/m1/s1 |
| InChIKey | RDWXHMKITLLLOX-LJQANCHMSA-N |
| XLogP | 4.33 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |