C20H26N2O3S — CID 2991415
2-[2-methoxy-4-[(thiophen-2-ylmethylamino)methyl]phenoxy]-1-piperidin-1-ylethanone (PubChem CID 2991415) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(thiophen-2-ylmethylamino)methyl]phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-methoxy-4-[(thiophen-2-ylmethylamino)methyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 2991415 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[2-methoxy-4-[(thiophen-2-ylmethylamino)methyl]phenoxy]-1-piperidin-1-ylethanone |
| SMILES | COc1cc(CNCc2cccs2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H26N2O3S/c1-24-19-12-16(13-21-14-17-6-5-11-26-17)7-8-18(19)25-15-20(23)22-9-3-2-4-10-22/h5-8,11-12,21H,2-4,9-10,13-15H2,1H3 |
| InChIKey | XMUDSVYMKMXKQX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |