C23H27N3O7 — CID 25163897
3-methoxy-N'-[2-(4-methylphenoxy)acetyl]-4-(2-morpholin-4-yl-2-oxoethoxy)benzohydrazide (PubChem CID 25163897) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-methoxy-N'-[2-(4-methylphenoxy)acetyl]-4-(2-morpholin-4-yl-2-oxoethoxy)benzohydrazide.
| Compound Name | 3-methoxy-N'-[2-(4-methylphenoxy)acetyl]-4-(2-morpholin-4-yl-2-oxoethoxy)benzohydrazide |
|---|---|
| PubChem CID | 25163897 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-methoxy-N'-[2-(4-methylphenoxy)acetyl]-4-(2-morpholin-4-yl-2-oxoethoxy)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccc(C)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H27N3O7/c1-16-3-6-18(7-4-16)32-14-21(27)24-25-23(29)17-5-8-19(20(13-17)30-2)33-15-22(28)26-9-11-31-12-10-26/h3-8,13H,9-12,14-15H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | GBNGJLDGDPVRBJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|