C26H33N3O5 — CID 4847857
N-(1-benzylpiperidin-4-yl)-3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzamide (PubChem CID 4847857) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzamide |
|---|---|
| PubChem CID | 4847857 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(Cc3ccccc3)CC2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H33N3O5/c1-32-24-17-21(7-8-23(24)34-19-25(30)29-13-15-33-16-14-29)26(31)27-22-9-11-28(12-10-22)18-20-5-3-2-4-6-20/h2-8,17,22H,9-16,18-19H2,1H3,(H,27,31) |
| InChIKey | XTKILCSJEATALO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |