C20H21ClN2O3 — CID 55783455
3-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]-4-methoxybenzamide (PubChem CID 55783455) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 3-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]-4-methoxybenzamide.
| Compound Name | 3-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55783455 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)C1(c2cccc(Cl)c2)CCCC1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-26-17-8-7-13(18(22)24)11-16(17)23-19(25)20(9-2-3-10-20)14-5-4-6-15(21)12-14/h4-8,11-12H,2-3,9-10H2,1H3,(H2,22,24)(H,23,25) |
| InChIKey | GKIZHGLAIFIWGG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |