C19H15ClFNO3 — CID 17058404
4-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylamino]-3-methylbenzoic acid (PubChem CID 17058404) has the molecular formula C19H15ClFNO3 and a molecular weight of 359.78 g/mol. Its IUPAC name is 4-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylamino]-3-methylbenzoic acid.
| Compound Name | 4-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 17058404 |
| Molecular Formula | C19H15ClFNO3 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylamino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NCc1ccc(-c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H15ClFNO3/c1-11-8-13(19(23)24)3-6-17(11)22-10-14-4-7-18(25-14)12-2-5-16(21)15(20)9-12/h2-9,22H,10H2,1H3,(H,23,24) |
| InChIKey | WFIOCYUAOLCXEV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |